CymitQuimica logo

CAS 927800-86-0

:

2-(2-Furanyl)-4-oxazolecarboxylic acid

Description:
2-(2-Furanyl)-4-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of both a furan ring and an oxazole ring in its structure. The furan moiety contributes to its aromatic properties, while the oxazole ring introduces nitrogen into the cyclic structure, enhancing its reactivity and potential biological activity. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The carboxylic acid group also imparts acidic characteristics, allowing for potential interactions in various chemical environments. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structure allows for potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Overall, 2-(2-Furanyl)-4-oxazolecarboxylic acid is notable for its structural complexity and potential utility in various chemical and biological contexts.
Formula:C8H5NO4
InChI:InChI=1S/C8H5NO4/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-4H,(H,10,11)
InChI key:InChIKey=FWWNGTSPPOYUJZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(OC1)C2=CC=CO2
Synonyms:
  • 2-(2-Furanyl)-4-oxazolecarboxylic acid
  • 4-Oxazolecarboxylic acid, 2-(2-furanyl)-
  • 2-(Furan-2-yl)-1,3-oxazole-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.