CAS 927801-67-0

2-Methylthiazolo[5,4-b]pyridine-6-carboxylic acid

Description:

2-Methylthiazolo[5,4-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its fused thiazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and making it soluble in polar solvents. The presence of the methyl group on the thiazole ring influences its electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with thiazole and pyridine derivatives. Additionally, its molecular framework may allow for various synthetic modifications, enabling the exploration of structure-activity relationships. As with many heterocycles, the compound may exhibit interesting properties such as fluorescence or coordination with metal ions, which could be relevant in materials science or catalysis. Overall, 2-Methylthiazolo[5,4-b]pyridine-6-carboxylic acid represents a versatile scaffold for further research and development in various chemical fields.

Formula: C₈H₆N₂O₂S

InChI: InChI=1S/C8H6N2O2S/c1-4-10-6-2-5(8(11)12)3-9-7(6)13-4/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=ZMOVNBGEVRHQBL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=NC1)SC(C)=N2

Synonyms:

• Thiazolo[5,4-b]pyridine-6-carboxylic acid, 2-methyl-
• 2-Methylthiazolo[5,4-b]pyridine-6-carboxylic acid

2-Methyl-[1,3]thiazolo[5,4-b]pyridine-6-carboxylic acid

CAS: 927801-67-0

Versatile small molecule scaffold

Formula: C₈H₆N₂O₂S

Purity: Min. 95%

Molecular weight: 194.2 g/mol

Ref: 3D-CMB80167