CAS 927802-39-9
:2-(2-Thiazolyl)benzoic acid
Description:
2-(2-Thiazolyl)benzoic acid, identified by its CAS number 927802-39-9, is an organic compound characterized by the presence of both a thiazole and a benzoic acid moiety. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The thiazole ring contributes to its potential biological activity, as thiazoles are known for their roles in pharmaceuticals and agrochemicals. The carboxylic acid functional group in the benzoic acid portion provides acidic properties, allowing for potential interactions in various chemical environments. Additionally, the compound may exhibit interesting properties such as fluorescence or UV absorption, which can be useful in analytical applications. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific reactivity and stability characteristics would depend on the conditions under which the compound is used, including pH, temperature, and the presence of other reagents.
Formula:C10H7NO2S
InChI:InChI=1S/C10H7NO2S/c12-10(13)8-4-2-1-3-7(8)9-11-5-6-14-9/h1-6H,(H,12,13)
InChI key:InChIKey=FQRCVHZNITWETI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C2=NC=CS2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.