CymitQuimica logo

CAS 927891-82-5

:

2-(Trifluoromethoxy)benzenepropanenitrile

Description:
2-(Trifluoromethoxy)benzenepropanenitrile, with the CAS number 927891-82-5, is an organic compound characterized by the presence of a trifluoromethoxy group and a nitrile functional group attached to a benzene ring. This compound typically exhibits a high degree of polarity due to the electronegative fluorine atoms, which can influence its solubility and reactivity. The trifluoromethoxy group enhances the compound's lipophilicity and may impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The nitrile group contributes to the compound's potential as a building block in organic synthesis, as it can participate in nucleophilic reactions. Additionally, the presence of the aromatic benzene ring provides stability and can facilitate π-π stacking interactions. Overall, 2-(Trifluoromethoxy)benzenepropanenitrile is a versatile compound with potential applications in medicinal chemistry and materials science, although specific reactivity and stability would depend on the surrounding conditions and substituents.
Formula:C10H8F3NO
InChI:InChI=1S/C10H8F3NO/c11-10(12,13)15-9-6-2-1-4-8(9)5-3-7-14/h1-2,4,6H,3,5H2
InChI key:InChIKey=NFELRHJRIXQNAP-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(CCC#N)C=CC=C1
Synonyms:
  • 3-(2-Trifluoromethoxyphenyl)propionitrile
  • Benzenepropanenitrile, 2-(trifluoromethoxy)-
  • 2-(Trifluoromethoxy)benzenepropanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.