CAS 927982-46-5

2-(3-methoxyphenoxy)ethanethioamide

Description:

2-(3-Methoxyphenoxy)ethanethioamide is an organic compound characterized by its unique functional groups, which include a thioamide and an ether linkage. The presence of the methoxy group on the aromatic ring contributes to its potential solubility in organic solvents and may influence its reactivity and biological activity. The thioamide functional group is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(3-methoxyphenoxy)ethanethioamide represents a versatile structure that could be explored for various chemical and biological applications.

Formula: C₉H₁₁NO₂S

InChI: InChI=1/C9H11NO2S/c1-11-7-3-2-4-8(5-7)12-6-9(10)13/h2-5H,6H2,1H3,(H2,10,13)

SMILES: COc1cccc(c1)OCC(=N)S

Synonyms:

• Ethanethioamide, 2-(3-Methoxyphenoxy)-
• 2-(3-Methoxyphenoxy)ethanethioamide