CAS 927986-30-9

1-cyclopropyl-1-(1-methyl-1H-imidazol-2-yl)methanamine

Description:

1-Cyclopropyl-1-(1-methyl-1H-imidazol-2-yl)methanamine is an organic compound characterized by its unique structure, which includes a cyclopropyl group and an imidazole moiety. This compound features a primary amine functional group, which contributes to its reactivity and potential as a ligand in coordination chemistry. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and biologically active compounds. The cyclopropyl group can impart strain and influence the compound's conformational flexibility, potentially affecting its interaction with biological targets. Additionally, the compound's molecular structure may exhibit specific solubility and stability characteristics, which are important for its application in various chemical contexts. Overall, 1-cyclopropyl-1-(1-methyl-1H-imidazol-2-yl)methanamine represents a compound of interest in medicinal chemistry and materials science due to its distinctive structural features and potential functional properties.

Formula: C₈H₁₃N₃

InChI: InChI=1/C8H13N3/c1-11-5-4-10-8(11)7(9)6-2-3-6/h4-7H,2-3,9H2,1H3

SMILES: Cn1ccnc1C(C1CC1)N

Synonyms:

• 1H-imidazole-2-methanamine, α-cyclopropyl-1-methyl-
• 1-Cyclopropyl-1-(1-methyl-1H-imidazol-2-yl)methanamine
• 1H-imidazole-2-methanamine, 伪-cyclopropyl-1-methyl-