CAS 927993-42-8
:2-[[(4-Methoxyphenyl)methyl]amino]-4-methyl-5-thiazolecarboxylic acid
Description:
2-[[(4-Methoxyphenyl)methyl]amino]-4-methyl-5-thiazolecarboxylic acid, with the CAS number 927993-42-8, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidic properties, and an amine group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the methoxyphenyl group adds to its lipophilicity and may influence its biological activity. The methyl group on the thiazole ring can affect the compound's steric properties and reactivity. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses.
Formula:C13H14N2O3S
InChI:InChI=1S/C13H14N2O3S/c1-8-11(12(16)17)19-13(15-8)14-7-9-3-5-10(18-2)6-4-9/h3-6H,7H2,1-2H3,(H,14,15)(H,16,17)
InChI key:InChIKey=YQXJVEMIWVAHHT-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(OC)C=C1)C=2SC(C(O)=O)=C(C)N2
Synonyms:- 2-[[(4-Methoxyphenyl)methyl]amino]-4-methyl-5-thiazolecarboxylic acid
- 2-(4-Methoxy-benzylamino)-4-methyl-thiazole-5-carboxylic acid
- 2-[[(4-Methoxyphenyl)methyl]amino]-4-methyl-1,3-thiazole-5-carboxylic acid
- 5-Thiazolecarboxylic acid, 2-[[(4-methoxyphenyl)methyl]amino]-4-methyl-
- 2-[(4-Methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.