CAS 928-04-1
:2-Butynedioic acid, potassium salt (1:1)
Description:
2-Butynedioic acid, potassium salt (1:1), also known as potassium 2-butynoate, is a chemical compound characterized by its role as a salt derived from 2-butynedioic acid. It typically appears as a white to off-white crystalline solid and is soluble in water, which facilitates its use in various applications. The compound features a dicarboxylic acid structure, with two carboxylate groups (-COO⁻) that are deprotonated in the salt form, allowing it to participate in various chemical reactions. Its potassium salt form enhances its stability and solubility compared to the free acid. This compound is often utilized in organic synthesis, particularly in the production of other organic compounds, and may also have applications in agriculture as a potential herbicide or plant growth regulator. Additionally, it can serve as a precursor in the synthesis of various pharmaceuticals and fine chemicals. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C4H2O4·K
InChI:InChI=1S/C4H2O4.K/c5-3(6)1-2-4(7)8;/h(H,5,6)(H,7,8);
InChI key:InChIKey=PJVDYLASYHLNQS-UHFFFAOYSA-N
SMILES:C(#CC(O)=O)C(O)=O.[K]
Synonyms:- 2-Butynedioic acid monopotassium salt
- 2-Butynedioic acid, potassium salt (1:1)
- Monopotassium acetylenedicarboxylate
- Potassium 3-Carboxypropiolate
- Potassium But-2-Ynedioate
- Potassium hydrogen acetylenedicarboxylate
- Acetylenedicarboxylic acid, monopotassium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Potassium 3-carboxyprop-2-ynoate
CAS:Potassium 3-carboxyprop-2-ynoatePurity:98%Molecular weight:152.15g/molAcetylenedicarboxylic Acid Monopotassium Salt
CAS:Formula:C4HKO4Purity:>95.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:152.15Acetylene dicarboxylic acid potassium salt
CAS:Acetylene dicarboxylic acid potassium salt (ADAC) is a drug that belongs to the class of 2-fluorobenzoic acid derivatives. Acetylene dicarboxylic acid potassium salt inhibits the enzyme 2,3-dihydroxybenzoate-4-hydroxylase and reduces the production of propiolic acid, which leads to a decrease in the synthesis of tetracene. Acetylene dicarboxylic acid potassium salt has been shown to be an effective anesthetic, with good visual and motor activity. The high toxicity of this compound is due to its high affinity for protein binding sites and its ability to form hydrogen bonds.Formula:C4H2KO4Purity:Min. 95%Molecular weight:153.15 g/mol


