CAS 928-24-5
:1,1′-(1,2-Ethanediyl) di-(9Z)-9-octadecenoate
Description:
1,1′-(1,2-Ethanediyl) di-(9Z)-9-octadecenoate, commonly known as dioleoyl ethylene glycol, is an ester derived from oleic acid and ethylene glycol. This compound features two long hydrocarbon chains, each containing 18 carbon atoms with a cis double bond at the ninth position, contributing to its unsaturated nature. The presence of the ethylene glycol moiety provides hydrophilic characteristics, making it amphiphilic, which is significant in various applications, including emulsifiers and surfactants. The compound is typically a viscous liquid at room temperature and is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic fatty acid chains. Its unique structure allows it to form micelles and liposomes, making it valuable in drug delivery systems and cosmetic formulations. Additionally, the compound's stability and compatibility with biological systems enhance its potential in pharmaceutical and food industries. Overall, 1,1′-(1,2-Ethanediyl) di-(9Z)-9-octadecenoate is a versatile chemical with important applications in various fields.
Formula:C38H70O4
InChI:InChI=1S/C38H70O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(39)41-35-36-42-38(40)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/b19-17-,20-18-
InChI key:InChIKey=NKSOSPOXQKNIKJ-CLFAGFIQSA-N
SMILES:O(CCOC(CCCCCCC/C=C\CCCCCCCC)=O)C(CCCCCCC/C=C\CCCCCCCC)=O
Synonyms:- Oleic acid, ethylene ester
- 9-Octadecenoic acid (Z)-, 1,2-ethanediyl ester
- 1,2-Ethanediyl dioleate
- ethane-1,2-diyl (9E,9'E)bis-octadec-9-enoate
- Dioleoyl ethylene glycol
- Ethylene glycol, dioleate
- 9-Octadecenoic acid (9Z)-, 1,1′-(1,2-ethanediyl) ester
- 9-Octadecenoic acid (9Z)-, 1,2-ethanediyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
18:1 Ethylene Glycol
CAS:18:1 Ethylene Glycol is a liposome used to deliver agents.Formula:C38H70O4Color and Shape:SolidMolecular weight:590.96
