CAS 928000-19-5
:N~1~,N~1~-dimethyl-1-(2-methylphenyl)ethane-1,2-diamine
Description:
N,N-Dimethyl-1-(2-methylphenyl)ethane-1,2-diamine, with the CAS number 928000-19-5, is an organic compound characterized by its amine functional groups. This substance features a central ethane backbone with two amine groups (–NH) and two methyl groups attached to one of the nitrogen atoms, contributing to its classification as a dimethylamine derivative. The presence of a 2-methylphenyl group indicates that it has a substituted aromatic ring, which can influence its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds of this nature may exhibit basicity due to the amine groups and can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Additionally, the steric hindrance introduced by the methyl groups and the aromatic ring can affect the compound's reactivity and interaction with biological systems. Safety data and handling precautions should be consulted, as amines can be hazardous and may require specific storage conditions.
Formula:C11H18N2
InChI:InChI=1/C11H18N2/c1-9-6-4-5-7-10(9)11(8-12)13(2)3/h4-7,11H,8,12H2,1-3H3
SMILES:Cc1ccccc1C(CN)N(C)C
Synonyms:- 1,2-ethanediamine, N1
- N-[2-amino-1-(2-methylphenyl)ethyl]-N,N-dimethylamine
- N1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.