CAS 928025-43-8
:3-(2-Methylpropyl)-1-(phenylmethyl)piperazine
Description:
3-(2-Methylpropyl)-1-(phenylmethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 2-methylpropyl group and a phenylmethyl group attached to the piperazine ring, contributing to its unique structural and functional properties. The presence of these substituents can influence the compound's solubility, polarity, and potential biological activity. Typically, piperazine derivatives are known for their applications in pharmaceuticals, particularly as anxiolytics, antidepressants, and antipsychotics. The specific arrangement of the substituents in this compound may also affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular weight, melting point, and boiling point would be relevant for practical applications, although these specific values are not provided here. Overall, 3-(2-Methylpropyl)-1-(phenylmethyl)piperazine represents a class of compounds that may exhibit diverse pharmacological effects due to its structural characteristics.
Formula:C15H24N2
InChI:InChI=1S/C15H24N2/c1-13(2)10-15-12-17(9-8-16-15)11-14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3
InChI key:InChIKey=HQMROSCVRBNRRZ-UHFFFAOYSA-N
SMILES:C(N1CC(CC(C)C)NCC1)C2=CC=CC=C2
Synonyms:- Piperazine, 3-(2-methylpropyl)-1-(phenylmethyl)-
- 1-Benzyl-3-isobutylpiperazine
- 1-Benzyl-3-(2-methylpropyl)piperazine
- 3-(2-Methylpropyl)-1-(phenylmethyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.