CymitQuimica logo

CAS 928025-57-4

:

tert-butyl (3R)-3-propylpiperazine-1-carboxylate

Description:
Tert-butyl (3R)-3-propylpiperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a tert-butyl group, which is a bulky substituent that can influence its solubility and steric properties. The presence of the propyl group at the 3-position of the piperazine ring contributes to its hydrophobic characteristics, while the carboxylate functional group at the 1-position is indicative of its potential as a precursor in various chemical syntheses or as a pharmacophore in medicinal chemistry. This compound may exhibit specific biological activities due to its structural features, making it of interest in drug development. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and potential applications. As with many piperazine derivatives, it may also exhibit diverse pharmacological properties, including effects on the central nervous system, depending on its specific configuration and substituents.
Formula:C12H24N2O2
InChI:InChI=1/C12H24N2O2/c1-5-6-10-9-14(8-7-13-10)11(15)16-12(2,3)4/h10,13H,5-9H2,1-4H3/t10-/m1/s1
InChI key:UTQYTJHYWCCQIJ-SNVBAGLBSA-N
SMILES:CCC[C@@H]1CN(CCN1)C(=O)OC(C)(C)C
Synonyms:
  • 2-Methyl-2-propanyl (3R)-3-propyl-1-piperazinecarboxylate
  • tert-Butyl-(3R)-3-propylpiperazin-1-carboxylat
Found 5 products.