CAS 928025-59-6
:1,1-Dimethylethyl (3R)-3-butyl-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl (3R)-3-butyl-1-piperazinecarboxylate, with the CAS number 928025-59-6, is a chemical compound characterized by its piperazine structure, which is a six-membered ring containing two nitrogen atoms. This compound features a butyl group and a tert-butyl group, contributing to its hydrophobic characteristics. It is typically classified as an ester due to the presence of the carboxylate functional group. The stereochemistry indicated by the (3R) designation suggests that the compound has specific spatial arrangements that can influence its biological activity and interactions. Such compounds may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the piperazine ring often enhances solubility in polar solvents and can affect the compound's reactivity. Overall, the unique combination of functional groups and stereochemistry in 1,1-Dimethylethyl (3R)-3-butyl-1-piperazinecarboxylate contributes to its potential applications in drug development and other chemical processes.
Formula:C13H26N2O2
InChI:InChI=1S/C13H26N2O2/c1-5-6-7-11-10-15(9-8-14-11)12(16)17-13(2,3)4/h11,14H,5-10H2,1-4H3/t11-/m1/s1
InChI key:InChIKey=ZNICOTLOPCODTO-LLVKDONJSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@@H](CCCC)NCC1
Synonyms:- 1-Piperazinecarboxylic acid, 3-butyl-, 1,1-dimethylethyl ester, (3R)-
- (R)-1-Boc-3-Butylpiperazine
- 1,1-Dimethylethyl (3R)-3-butyl-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
