
CAS 928034-31-5
:1,1-Dimethylethyl 8-(phenylmethyl)-1,8-diazaspiro[4.5]decane-1-carboxylate
Description:
1,1-Dimethylethyl 8-(phenylmethyl)-1,8-diazaspiro[4.5]decane-1-carboxylate, identified by its CAS number 928034-31-5, is a chemical compound characterized by its unique spirocyclic structure, which includes a diazaspiro framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the 1,1-dimethylethyl group suggests steric hindrance, which may influence its interactions with other molecules. Additionally, the phenylmethyl substituent can enhance lipophilicity, potentially affecting its biological activity and pharmacokinetics. The compound's structure indicates it may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a complex molecular architecture that could be of interest in various chemical and biological applications.
Formula:C20H30N2O2
InChI:InChI=1S/C20H30N2O2/c1-19(2,3)24-18(23)22-13-7-10-20(22)11-14-21(15-12-20)16-17-8-5-4-6-9-17/h4-6,8-9H,7,10-16H2,1-3H3
InChI key:InChIKey=HOENQQSYMLKEEX-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2(CCN(CC3=CC=CC=C3)CC2)CCC1
Synonyms:- 1,8-Diazaspiro[4.5]decane-1-carboxylic acid, 8-(phenylmethyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 8-(phenylmethyl)-1,8-diazaspiro[4.5]decane-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.