CAS 92806-99-0

1-(2,3-Dihydro-2-thioxo-1H-benzimidazol-5-yl)ethanone

Description:

1-(2,3-Dihydro-2-thioxo-1H-benzimidazol-5-yl)ethanone, with the CAS number 92806-99-0, is a chemical compound that features a benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound is characterized by the presence of a thioxo group, which contributes to its reactivity and potential biological activity. The ethanone moiety indicates that it has a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions. The dihydro form suggests that the compound may exhibit some degree of saturation, influencing its stability and reactivity. This substance may have applications in medicinal chemistry, particularly due to the presence of the benzimidazole structure, which is known for its pharmacological properties. Additionally, the thioxo group may impart unique characteristics, such as increased electron density or potential coordination with metal ions. Overall, this compound's structural features suggest it may be of interest in various chemical and biological research contexts.

Formula: C₉H₈N₂OS

InChI: InChI=1S/C9H8N2OS/c1-5(12)6-2-3-7-8(4-6)11-9(13)10-7/h2-4H,1H3,(H2,10,11,13)

InChI key: InChIKey=ZAVMSMBCGKEASC-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=C2C(=CC1)NC(=S)N2

Synonyms:

• Ethanone, 1-(2,3-dihydro-2-thioxo-1H-benzimidazol-5-yl)-
• 5-Acetyl-2-mercapto-1H-benzimidazole
• 5-Acetyl-2-mercaptobenzimidazole
• 1-(2,3-Dihydro-2-thioxo-1H-benzimidazol-5-yl)ethanone
• 1-(2-Sulfanyl-1H-1,3-benzodiazol-5-yl)ethan-1-one