CAS 928134-65-0

4-(R)-(6,7-Dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)-3-fluorobenzonitrile

Description:

4-(R)-(6,7-Dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)-3-fluorobenzonitrile, with the CAS number 928134-65-0, is a chemical compound characterized by its complex structure, which includes a pyrrolo[1,2-c]imidazole moiety and a fluorobenzonitrile group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The pyrrolo[1,2-c]imidazole framework is known for its role in various pharmacological activities, including potential anticancer and anti-inflammatory effects. Additionally, the nitrile group may contribute to the compound's reactivity and ability to form hydrogen bonds, which can be crucial for its biological activity. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential in drug discovery.

Formula: C₁₃H₁₀FN₃

InChI: InChI=1S/C13H10FN3/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13/h1,3,5,7-8,13H,2,4H2/t13-/m1/s1

InChI key: InChIKey=USUZGMWDZDXMDG-CYBMUJFWSA-N

SMILES: FC1=C([C@@H]2N3C(CC2)=CN=C3)C=CC(C#N)=C1

Synonyms:

• Benzonitrile, 4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluoro-
• 4-[(5R)-6,7-Dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile
• Osilodrostat
• LCI 699
• 4-(R)-(6,7-Dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)-3-fluorobenzonitrile

Osilodrostat

CAS: 928134-65-0

Formula: C₁₃H₁₀FN₃

Molecular weight: 227.24

Ref: 4Z-O-138001

Osilodrostat

CAS: 928134-65-0

Osilodrostat (LCI699) is a potent inhibitor of human 11β-hydroxylase (CYP11B1) and aldosterone synthase (CYP11B2).Cost-effective and quality-assured.

Formula: C₁₃H₁₀FN₃

Purity: 99.10% - 99.36%

Color and Shape: Solid

Molecular weight: 227.24

Ref: TM-T4277

Osilodrostat

Controlled Product

CAS: 928134-65-0

Formula: C₁₃H₁₀FN₃

Color and Shape: Beige

Molecular weight: 227.24

Ref: TR-O820505

LCI699

CAS: 928134-65-0

Formula: C₁₃H₁₀FN₃

Purity: 99%

Color and Shape: Solid

Molecular weight: 227.2370

Ref: IN-DA00H1JR