CymitQuimica logo

CAS 928160-89-8

:

B-[5-Methyl-6-(4-thiomorpholinyl)-3-pyridinyl]boronic acid

Description:
B-[5-Methyl-6-(4-thiomorpholinyl)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a pyridine ring substituted with a methyl group and a thiomorpholine moiety, which contributes to its potential biological activity. The thiomorpholine ring enhances the compound's solubility and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of boronic acids, such as being a weak acid and having the ability to participate in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, its structural features suggest potential applications in drug development, particularly in targeting specific enzymes or receptors. As with many boronic acids, it may also exhibit sensitivity to moisture and air, necessitating careful handling and storage conditions.
Formula:C10H15BN2O2S
InChI:InChI=1S/C10H15BN2O2S/c1-8-6-9(11(14)15)7-12-10(8)13-2-4-16-5-3-13/h6-7,14-15H,2-5H2,1H3
InChI key:InChIKey=IMBFDHOOBFMSED-UHFFFAOYSA-N
SMILES:CC1=C(N=CC(B(O)O)=C1)N2CCSCC2
Synonyms:
  • Boronic acid, B-[5-methyl-6-(4-thiomorpholinyl)-3-pyridinyl]-
  • B-[5-Methyl-6-(4-thiomorpholinyl)-3-pyridinyl]boronic acid
  • [5-Methyl-6-(thiomorpholin-4-yl)pyridin-3-yl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.