CymitQuimica logo

CAS 928165-59-7

:

3-Chloro-1-(4-octylphenyl)-1-propanone

Description:
3-Chloro-1-(4-octylphenyl)-1-propanone, identified by its CAS number 928165-59-7, is an organic compound characterized by its ketone functional group and the presence of a chlorine atom. This compound features a propanone backbone with a chlorinated substituent at the third carbon and a phenyl group with an octyl chain at the first carbon. The octylphenyl moiety contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The presence of the chlorine atom can influence its reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may be of interest in fields such as organic synthesis, materials science, or pharmaceuticals, where its unique structure could impart specific properties or functionalities. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C17H25ClO
InChI:InChI=1S/C17H25ClO/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17(19)13-14-18/h9-12H,2-8,13-14H2,1H3
SMILES:CCCCCCCCc1ccc(cc1)C(=O)CCCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.