CAS 92817-11-3

Estra-1,3,5(10)-triene-3,17-diol, 16-fluoro-, (16α,17α)-

Description:

Estra-1,3,5(10)-triene-3,17-diol, 16-fluoro-, (16α,17α)-, commonly referred to as a synthetic steroid, is characterized by its structural modifications that include a fluorine atom at the 16-position and hydroxyl groups at the 3 and 17 positions. This compound is part of the steroid family, which is known for its four-ring carbon structure. The presence of the double bonds in the A and B rings contributes to its reactivity and biological activity. The specific stereochemistry indicated by (16α,17α) suggests a particular spatial arrangement of atoms that can influence the compound's interaction with biological receptors, potentially affecting its pharmacological properties. Estra-1,3,5(10)-triene derivatives are often studied for their potential applications in hormone replacement therapy and other therapeutic areas. Additionally, the fluorine substitution can enhance metabolic stability and alter the compound's affinity for steroid receptors, making it a subject of interest in medicinal chemistry and endocrinology.

Formula: C₁₈H₂₃FO₂

InChI: InChI=1S/C18H23FO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-17,20-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17-,18+/m1/s1

InChI key: InChIKey=KDLLNMRYZGUVMA-PNVOZDDCSA-N

SMILES: C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=CC(O)=CC4)(CC1)[H])[H])(C[C@@H](F)[C@H]2O)[H]

Synonyms:

• 16α-Fluoroestra-1,3,5(10)-triene-3,17α-diol
• Estra-1,3,5(10)-triene-3,17-diol, 16-fluoro-, (16α,17α)-

Estradiol Impurity 11

CAS: 92817-11-3

Formula: C₁₈H₂₃FO₂

Color and Shape: White To Off-White Solid

Molecular weight: 290.38

Ref: 4Z-E-0991