
CAS 928322-46-7
:3-Fluoro-4-(4-nitrophenyl)pyridine
Description:
3-Fluoro-4-(4-nitrophenyl)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 3-position with a fluorine atom and at the 4-position with a para-nitrophenyl group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and acetone, but may have limited solubility in water. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions in chemical reactions. The fluorine atom enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and UV-Vis spectroscopy, aiding in its identification and analysis. Safety data should be consulted, as compounds containing nitro groups can be hazardous and require careful handling.
Formula:C11H7FN2O2
InChI:InChI=1S/C11H7FN2O2/c12-11-7-13-6-5-10(11)8-1-3-9(4-2-8)14(15)16/h1-7H
InChI key:InChIKey=GEARXMITLJZVDI-UHFFFAOYSA-N
SMILES:FC=1C(C2=CC=C(N(=O)=O)C=C2)=CC=NC1
Synonyms:- Pyridine, 3-fluoro-4-(4-nitrophenyl)-
- 3-Fluoro-4-(4-nitrophenyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.