CymitQuimica logo

CAS 92841-23-1

:

6-Chloro-2-ethyl-9H-carbazole

Description:
6-Chloro-2-ethyl-9H-carbazole is an organic compound characterized by its structure, which includes a carbazole core substituted with a chlorine atom at the 6-position and an ethyl group at the 2-position. This compound is part of the carbazole family, known for its aromatic properties and potential applications in organic electronics, such as in light-emitting diodes (LEDs) and organic photovoltaics. The presence of the chlorine atom can influence its reactivity and solubility, while the ethyl group may enhance its hydrophobic characteristics. Typically, compounds like 6-Chloro-2-ethyl-9H-carbazole exhibit fluorescence, making them useful in various photonic applications. Additionally, the compound's stability and behavior under different conditions can be influenced by its molecular structure, which may also affect its interactions with other chemical species. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 6-Chloro-2-ethyl-9H-carbazole represents a significant compound in the field of organic chemistry and materials science.
Formula:C14H12ClN
InChI:InChI=1S/C14H12ClN/c1-2-9-3-5-11-12-8-10(15)4-6-13(12)16-14(11)7-9/h3-8,16H,2H2,1H3
InChI key:InChIKey=MVPBNCKQNLUXLA-UHFFFAOYSA-N
SMILES:ClC=1C=C2C=3C(NC2=CC1)=CC(CC)=CC3
Synonyms:
  • 9H-Carbazole, 6-chloro-2-ethyl-
  • 6-Chloro-2-ethyl-9H-carbazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.