CAS 92863-34-8
:Methyl 4-cyclohexylbenzoate
Description:
Methyl 4-cyclohexylbenzoate is an organic compound classified as an ester, specifically derived from benzoic acid and cyclohexanol. It features a methyl ester functional group attached to a benzoate moiety, with a cyclohexyl group positioned at the para position of the benzene ring. This compound typically appears as a colorless to pale yellow liquid with a characteristic aromatic odor. It is relatively non-polar, which influences its solubility in organic solvents while being less soluble in water. Methyl 4-cyclohexylbenzoate is often used in the synthesis of various chemical intermediates and may also find applications in the fragrance and flavor industry due to its pleasant scent. Additionally, it may exhibit moderate stability under standard conditions, but like many organic compounds, it should be handled with care to avoid exposure to heat and light, which can lead to degradation. Safety data sheets should be consulted for specific handling and storage recommendations.
Formula:C14H18O2
InChI:InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h7-11H,2-6H2,1H3
SMILES:COC(=O)c1ccc(cc1)C1CCCCC1
Synonyms:- 4-Cyclohexylbenzoic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
