CAS 92864-23-8
:5-(2,5-dimethylphenyl)-3-methyl-5-oxo-pentanoic acid
Description:
5-(2,5-Dimethylphenyl)-3-methyl-5-oxo-pentanoic acid, with the CAS number 92864-23-8, is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone substituted with a 2,5-dimethylphenyl group and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. Its molecular structure suggests it may participate in various chemical reactions, such as esterification or acylation, due to the presence of the carboxylic acid group. The presence of the dimethylphenyl substituent may influence its reactivity and interactions, potentially enhancing its lipophilicity. This compound could be of interest in synthetic organic chemistry, pharmaceuticals, or materials science, although specific applications would depend on further research into its biological activity and reactivity. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C14H18O3
InChI:InChI=1/C14H18O3/c1-9-4-5-11(3)12(6-9)13(15)7-10(2)8-14(16)17/h4-6,10H,7-8H2,1-3H3,(H,16,17)
SMILES:Cc1ccc(C)c(c1)C(=O)CC(C)CC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.