CAS 92864-24-9

5-(3,4-dimethylphenyl)-3-methyl-5-oxo-pentanoic acid

Description:

5-(3,4-Dimethylphenyl)-3-methyl-5-oxo-pentanoic acid, with the CAS number 92864-24-9, is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone substituted with a 3,4-dimethylphenyl group and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid and ketone functionalities. The presence of the dimethylphenyl group may impart specific steric and electronic effects, influencing its reactivity and interactions in chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis and applications could involve various organic reactions, including acylation and oxidation processes. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₈O₃

InChI: InChI=1/C14H18O3/c1-9(7-14(16)17)6-13(15)12-5-4-10(2)11(3)8-12/h4-5,8-9H,6-7H2,1-3H3,(H,16,17)

SMILES: CC(CC(=O)c1ccc(C)c(C)c1)CC(=O)O