CAS 92864-99-8

(2E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoic acid

Description:

(2E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoic acid, with the CAS number 92864-99-8, is an organic compound characterized by its structure, which includes a prop-2-enoic acid moiety and a substituted phenyl group. The presence of the ethoxy and propoxy groups on the phenyl ring contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. This compound likely exhibits properties typical of unsaturated carboxylic acids, such as acidity and the ability to undergo various chemical reactions, including esterification and polymerization. The specific arrangement of substituents can also affect its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's geometric configuration (E or Z) indicates the spatial arrangement of substituents around the double bond, which can significantly impact its chemical behavior and interactions. Overall, this compound's unique structure and functional groups suggest potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₄H₁₈O₄

InChI: InChI=1/C14H18O4/c1-3-9-18-12-7-5-11(6-8-14(15)16)10-13(12)17-4-2/h5-8,10H,3-4,9H2,1-2H3,(H,15,16)/b8-6+

Synonyms:

• 2-propenoic acid, 3-(3-ethoxy-4-propoxyphenyl)-, (2E)-
• 3-(3-Ethoxy-4-propoxy-phenyl)-acrylic acid
• (2E)-3-(3-Ethoxy-4-propoxyphenyl)acrylic acid