CymitQuimica logo

CAS 92865-60-6

:

5-oxo-5-(2,4,5-trimethoxyphenyl)pentanoic acid

Description:
5-Oxo-5-(2,4,5-trimethoxyphenyl)pentanoic acid, with the CAS number 92865-60-6, is an organic compound characterized by its complex structure featuring a pentanoic acid backbone and a substituted aromatic ring. The presence of the oxo group (a carbonyl functional group) contributes to its reactivity and potential applications in organic synthesis. The trimethoxyphenyl substituent indicates that the compound has three methoxy (-OCH3) groups attached to a phenyl ring, which can influence its solubility, polarity, and biological activity. This compound may exhibit interesting pharmacological properties due to the presence of both the carboxylic acid and the aromatic moiety, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may be studied for its effects in various chemical reactions or as a precursor in the synthesis of more complex molecules. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reagents.
Formula:C14H18O6
InChI:InChI=1/C14H18O6/c1-18-11-8-13(20-3)12(19-2)7-9(11)10(15)5-4-6-14(16)17/h7-8H,4-6H2,1-3H3,(H,16,17)
SMILES:COc1cc(c(cc1C(=O)CCCC(=O)O)OC)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.