CAS 928653-73-0

5-bromo-2-chloro-3-iodo-pyridine

Description:

5-Bromo-2-chloro-3-iodo-pyridine is a halogenated pyridine derivative characterized by the presence of three different halogen substituents: bromine, chlorine, and iodine, located at the 5, 2, and 3 positions of the pyridine ring, respectively. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as dichloromethane and acetone, but may have limited solubility in water due to its aromatic nature and halogen substitutions. The presence of multiple halogens can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its unique structure allows for potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Safety precautions should be taken when handling this compound, as halogenated substances can be toxic and environmentally hazardous.

Formula: C₅H₂BrClIN

InChI: InChI=1/C5H2BrClIN/c6-3-1-4(8)5(7)9-2-3/h1-2H

SMILES: c1c(cnc(c1I)Cl)Br

Synonyms:

• Pyridine, 5-Bromo-2-Chloro-3-Iodo-

5-bromo-2-chloro-3-iodo-pyridine

CAS: 928653-73-0

Formula: C₅H₂BrClIN

Purity: 98%

Color and Shape: Solid

Molecular weight: 318.3375

Ref: IN-DA0036XO

5-Bromo-2-chloro-3-iodopyridine

CAS: 928653-73-0

Formula: C₅H₂BrClIN

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 318.34

Ref: 3B-B6219

5-Bromo-2-chloro-3-iodopyridine

CAS: 928653-73-0

5-Bromo-2-chloro-3-iodopyridine

Formula: C₅H₂BrClIN

Purity: 99%

Color and Shape: off-white to grey solid

Molecular weight: 318.34g/mol

Ref: 54-OR345455

5-Bromo-2-chloro-3-iodopyridine

CAS: 928653-73-0

Formula: C₅H₂BrClIN

Purity: 95%

Color and Shape: Solid

Molecular weight: 318.34

Ref: 10-F213342