CAS 928653-76-3
:5-Fluoro-3-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Description:
5-Fluoro-3-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, which include a pyrrolo[2,3-b]pyridine core substituted with fluorine and iodine atoms, as well as a tris(1-methylethyl)silyl group. The presence of halogen atoms (fluorine and iodine) typically enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The tris(1-methylethyl)silyl group contributes to the compound's stability and solubility, potentially affecting its interactions in various chemical environments. This compound may exhibit interesting properties such as lipophilicity due to the bulky silyl group, which can impact its pharmacokinetics if used in drug development. Additionally, the specific arrangement of atoms and functional groups can lead to unique electronic properties, making it a candidate for various applications in organic synthesis and material science. Overall, its structural complexity suggests potential utility in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C16H24FIN2Si
InChI:InChI=1S/C16H24FIN2Si/c1-10(2)21(11(3)4,12(5)6)20-9-15(18)14-7-13(17)8-19-16(14)20/h7-12H,1-6H3
InChI key:InChIKey=TUPFUIVWIXAUFW-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C(I)=C1)=CC(F)=CN2
Synonyms:- (5-Fluoro-3-iodopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane
- 5-Fluoro-3-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-fluoro-3-iodo-1-[tris(1-methylethyl)silyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.