CymitQuimica logo

CAS 928653-78-5

:

tert-butyl 5-fluoro-3-iodo-pyrrolo[2,3-b]pyridine-1-carboxylate

Description:
Tert-butyl 5-fluoro-3-iodo-pyrrolo[2,3-b]pyridine-1-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrrolopyridine framework. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential solubility in organic solvents. The presence of halogen substituents, specifically fluorine and iodine, can significantly influence its reactivity and biological activity, often enhancing its pharmacological properties. The fluorine atom may impart unique electronic characteristics, while the iodine atom can facilitate certain types of chemical reactions, such as nucleophilic substitutions. The carboxylate functional group is indicative of potential acid-base behavior and can participate in various chemical interactions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the design of novel therapeutic agents due to its structural features and substituents that can modulate biological activity. Its specific applications would depend on further studies regarding its efficacy and safety in biological systems.
Formula:C12H12FIN2O2
InChI:InChI=1/C12H12FIN2O2/c1-12(2,3)18-11(17)16-6-9(14)8-4-7(13)5-15-10(8)16/h4-6H,1-3H3
SMILES:CC(C)(C)OC(=O)n1cc(c2cc(cnc12)F)I
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.