CAS 928653-82-1

tert-butyl 5-chloropyrrolo[2,3-b]pyridine-1-carboxylate

Description:

Tert-butyl 5-chloropyrrolo[2,3-b]pyridine-1-carboxylate is a chemical compound characterized by its unique pyrrolo-pyridine structure, which incorporates a tert-butyl ester group and a chlorine substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the chlorine atom may influence its reactivity and solubility in various solvents, while the tert-butyl group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a carboxylate ester, it may undergo hydrolysis under certain conditions, releasing the corresponding carboxylic acid and alcohol. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to regulatory scrutiny depending on its intended use. Overall, tert-butyl 5-chloropyrrolo[2,3-b]pyridine-1-carboxylate represents a class of compounds with potential applications in drug discovery and development.

Formula: C₁₂H₁₃ClN₂O₂

InChI: InChI=1/C12H13ClN2O2/c1-12(2,3)17-11(16)15-5-4-8-6-9(13)7-14-10(8)15/h4-7H,1-3H3

SMILES: CC(C)(C)OC(=O)n1ccc2cc(cnc12)Cl

5-CHLORO-PYRROLO[2,3-B]PYRIDINE-1-CARBOXYLICACIDTERT-BUTYLESTER

CAS: 928653-82-1

Formula: C₁₂H₁₃ClN₂O₂

Purity: 99%

Molecular weight: 252.6968

Ref: IN-DA00GSV6

Tert-Butyl 5-Chloro-1H-Pyrrolo[2,3-B]Pyridine-1-Carboxylate

CAS: 928653-82-1

Tert-Butyl 5-Chloro-1H-Pyrrolo[2,3-B]Pyridine-1-Carboxylate

Purity: 99%

Molecular weight: 252.7g/mol

Ref: 54-OR1025591

tert-Butyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-1-carboxylate

CAS: 928653-82-1

Purity: 97%

Molecular weight: 252.6999969

Ref: 10-F608731