CAS 928653-83-2
:1,1-Dimethylethyl 5-methoxy-1H-pyrrolo[2,3-b]pyridine-1-carboxylate
Description:
1,1-Dimethylethyl 5-methoxy-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, identified by its CAS number 928653-83-2, is a chemical compound that features a pyrrolopyridine core, which is a bicyclic structure known for its biological activity. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) that enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The methoxy group at the 5-position of the pyrrolopyridine ring may contribute to its electronic properties and reactivity. Additionally, the carboxylate functional group is likely to play a role in the compound's interactions with biological targets, possibly affecting its pharmacological profile. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. However, specific details regarding its biological effects, synthesis, and applications would require further investigation and research.
Formula:C13H16N2O3
InChI:InChI=1S/C13H16N2O3/c1-13(2,3)18-12(16)15-6-5-9-7-10(17-4)8-14-11(9)15/h5-8H,1-4H3
InChI key:InChIKey=VHFWDIPVJZAJHB-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=C1)=CC(OC)=CN2
Synonyms:- 1,1-Dimethylethyl 5-methoxy-1H-pyrrolo[2,3-b]pyridine-1-carboxylate
- 1H-Pyrrolo[2,3-b]pyridine-1-carboxylic acid, 5-methoxy-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Methoxy-pyrrolo[2,3-b]pyridine-1-carboxylic acid tert-butyl ester
CAS:Formula:C13H16N2O3Molecular weight:248.2777
