CymitQuimica logo

CAS 928658-23-5

:

4-(6-bromopyridin-2-yl)benzoic acid

Description:
4-(6-Bromopyridin-2-yl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a pyridine ring substituted with a bromine atom. The presence of the bromine atom at the 6-position of the pyridine ring enhances its reactivity and can influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic carboxylic acids. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. Additionally, due to the presence of both the carboxylic acid and the heterocyclic pyridine, it may exhibit interesting pharmacological properties, potentially acting as a ligand in biological systems. Its molecular structure allows for various applications in medicinal chemistry, materials science, and as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H8BrNO2
InChI:InChI=1/C12H8BrNO2/c13-11-3-1-2-10(14-11)8-4-6-9(7-5-8)12(15)16/h1-7H,(H,15,16)
InChI key:LJVFAKRRQNUNES-UHFFFAOYSA-N
SMILES:c1cc(c2ccc(cc2)C(=O)O)nc(c1)Br
Synonyms:
  • Benzoic acid, 4-(6-bromo-2-pyridinyl)-
Found 2 products.