
CAS 92870-36-5
:5,5-Diethyl-1-(phenylmethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
5,5-Diethyl-1-(phenylmethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione, with the CAS number 92870-36-5, is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features two ethyl groups at the 5-position and a phenylmethyl group at the 1-position, contributing to its unique structural and electronic properties. The presence of the carbonyl groups at the 2, 4, and 6 positions of the pyrimidine ring indicates that it belongs to the class of pyrimidinetriones, which are known for their potential biological activity and utility in medicinal chemistry. The compound may exhibit various properties such as solubility in organic solvents, stability under certain conditions, and potential reactivity due to the functional groups present. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their roles in pharmaceuticals and agrochemicals.
Formula:C15H18N2O3
InChI:InChI=1S/C15H18N2O3/c1-3-15(4-2)12(18)16-14(20)17(13(15)19)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,16,18,20)
InChI key:InChIKey=YSCCFYUEQXOKHY-UHFFFAOYSA-N
SMILES:C(C)C1(CC)C(=O)N(CC2=CC=CC=C2)C(=O)NC1=O
Synonyms:- 1-Benzyl-5,5-diethylbarbituricacid
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-diethyl-1-(phenylmethyl)-
- Barbituric acid, 1-benzyl-5,5-diethyl-
- 5,5-Diethyl-1-(phenylmethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.