CAS 928707-70-4
:5-ethyl-1,3-dimethyl-1H-indole-2-carboxylic acid
Description:
5-Ethyl-1,3-dimethyl-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features an ethyl group and two methyl groups attached to the indole ring, contributing to its unique chemical properties. The carboxylic acid functional group (-COOH) at the second position of the indole ring imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The presence of multiple substituents on the indole ring can influence its solubility, reactivity, and potential biological activity. Compounds of this type may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can affect the compound's stereochemistry and interactions with biological targets. Overall, 5-ethyl-1,3-dimethyl-1H-indole-2-carboxylic acid represents a versatile structure with potential applications in drug development and organic synthesis.
Formula:C13H15NO2
InChI:InChI=1/C13H15NO2/c1-4-9-5-6-11-10(7-9)8(2)12(13(15)16)14(11)3/h5-7H,4H2,1-3H3,(H,15,16)
SMILES:CCc1ccc2c(c1)c(C)c(C(=O)O)n2C
Synonyms:- 1H-indole-2-carboxylic acid, 5-ethyl-1,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.