CAS 928708-27-4

Ethyl 4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzeneacetate

Description:

Ethyl 4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzeneacetate, identified by its CAS number 928708-27-4, is an organic compound characterized by its complex structure, which includes an ethyl ester group and a pyrrole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the aldehyde functional group. The pyrrole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the ethyl ester suggests that it may undergo hydrolysis under acidic or basic conditions, leading to the corresponding carboxylic acid. Additionally, the compound may exhibit UV-Vis absorbance due to its conjugated system, which can be useful for analytical purposes. Overall, this compound's unique structural features may confer specific chemical reactivity and biological properties, warranting further investigation for applications in pharmaceuticals or materials science.

Formula: C₁₇H₁₉NO₃

InChI: InChI=1S/C17H19NO3/c1-4-21-17(20)10-14-5-7-16(8-6-14)18-12(2)9-15(11-19)13(18)3/h5-9,11H,4,10H2,1-3H3

InChI key: InChIKey=ZIAXRSSFMLTIQH-UHFFFAOYSA-N

SMILES: CC=1N(C(C)=CC1C=O)C2=CC=C(CC(OCC)=O)C=C2

Synonyms:

• Ethyl 4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzeneacetate
• Benzeneacetic acid, 4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-, ethyl ester