CAS 928708-38-7

Benzonitrile, 3-[(3-formylphenoxy)methyl]-

Description:

Benzonitrile, 3-[(3-formylphenoxy)methyl]- is an organic compound characterized by its structure, which includes a benzonitrile moiety and a phenoxy group with a formyl substituent. This compound typically exhibits properties common to nitriles, such as a high boiling point and moderate solubility in organic solvents. The presence of the formyl group suggests potential reactivity, particularly in condensation reactions or as an electrophile in nucleophilic attacks. The phenoxy group can influence the compound's polarity and reactivity, making it suitable for various applications in organic synthesis and potentially in pharmaceuticals or agrochemicals. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential utility in various chemical processes.

Formula: C₁₅H₁₁NO₂

InChI: InChI=1S/C15H11NO2/c16-9-12-3-1-5-14(7-12)11-18-15-6-2-4-13(8-15)10-17/h1-8,10H,11H2

InChI key: InChIKey=YZLHXAJTYDJDPP-UHFFFAOYSA-N

SMILES: C(OC1=CC(C=O)=CC=C1)C2=CC(C#N)=CC=C2

Synonyms:

• 3-[(3-Formylphenoxy)methyl]benzonitrile
• Benzonitrile, 3-[(3-formylphenoxy)methyl]-

3-(3-Formylphenoxymethyl)benzonitrile

CAS: 928708-38-7

Versatile small molecule scaffold

Formula: C₁₅H₁₁NO₂

Purity: Min. 95%

Molecular weight: 237.25 g/mol

Ref: 3D-DMB70838