CAS 928708-60-5

1-(pyridin-3-ylmethyl)-1H-indole-3-carbaldehyde

Description:

1-(Pyridin-3-ylmethyl)-1H-indole-3-carbaldehyde is an organic compound characterized by its complex structure, which includes an indole moiety and a pyridine ring. This compound features a carbaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the pyridine ring enhances its electron-withdrawing properties, making it a useful building block in the development of pharmaceuticals and agrochemicals. The indole structure is known for its biological significance, often serving as a core structure in various natural products and bioactive compounds. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, which can be explored in research settings. Its CAS number, 928708-60-5, allows for easy identification and retrieval of information in chemical databases. Overall, 1-(pyridin-3-ylmethyl)-1H-indole-3-carbaldehyde represents a versatile compound with potential implications in various fields of chemistry and biology.

Formula: C₁₅H₁₂N₂O

InChI: InChI=1/C15H12N2O/c18-11-13-10-17(9-12-4-3-7-16-8-12)15-6-2-1-5-14(13)15/h1-8,10-11H,9H2

SMILES: c1ccc2c(c1)c(cn2Cc1cccnc1)C=O

Synonyms:

• 1H-indole-3-carboxaldehyde, 1-(3-pyridinylmethyl)-