CAS 928713-28-4

2-(2,4-Dichlorophenyl)-5-pyrimidinecarboxylic acid

Description:

2-(2,4-Dichlorophenyl)-5-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential acidity due to the carboxylic acid functional group. The presence of the dichlorophenyl moiety can influence its solubility, stability, and reactivity, often making it more lipophilic. It may also exhibit biological activity, which is common for compounds with similar structures, potentially serving as a lead compound in pharmaceutical research. The compound's molecular interactions can be significant in various applications, including medicinal chemistry and agrochemicals. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to regulatory scrutiny depending on its intended use. Overall, 2-(2,4-Dichlorophenyl)-5-pyrimidinecarboxylic acid represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₁H₆Cl₂N₂O₂

InChI: InChI=1S/C11H6Cl2N2O2/c12-7-1-2-8(9(13)3-7)10-14-4-6(5-15-10)11(16)17/h1-5H,(H,16,17)

InChI key: InChIKey=NLBONZZLGJIISN-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC(Cl)=C1)C=2N=CC(C(O)=O)=CN2

Synonyms:

• 5-Pyrimidinecarboxylic acid, 2-(2,4-dichlorophenyl)-
• 2-(2,4-Dichlorophenyl)-5-pyrimidinecarboxylic acid