CAS 928774-98-5

2,4,5,6,7,8-hexahydropyrazolo[3,4-d]azepine hydrochloride

Description:

2,4,5,6,7,8-hexahydropyrazolo[3,4-d]azepine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazolo and azepine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, which is common for many hydrochloride salts. The presence of the hydrochloride group enhances its solubility and stability, making it suitable for various applications in medicinal chemistry. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, although specific pharmacological properties would require further investigation. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. As with any compound, understanding its reactivity, stability, and potential toxicity is crucial for safe use and application in research or therapeutic contexts.

Formula: C₇H₁₂ClN₃

InChI: InChI=1/C7H11N3.ClH/c1-3-8-4-2-7-6(1)5-9-10-7;/h5,8H,1-4H2,(H,9,10);1H

SMILES: C1CNCCc2c1c[nH]n2.Cl

2,4,5,6,7,8-Hexahydropyrazolo[3,4-d]azepine hydrochloride

CAS: 928774-98-5

Formula: C₇H₁₂ClN₃

Color and Shape: Solid

Molecular weight: 173.6433

Ref: IN-DA00H17W

1H,4H,5H,6H,7H,8H-pyrazolo[3,4-d]azepine hydrochloride

CAS: 928774-98-5

Purity: 98+%

Molecular weight: 173.6399994

Ref: 10-F620974