CAS 929-10-2
:6-Methylheptanoic acid
Description:
6-Methylheptanoic acid, with the CAS number 929-10-2, is a branched-chain fatty acid characterized by its seven-carbon backbone and a methyl group located at the sixth carbon position. This compound is a colorless to pale yellow liquid at room temperature and has a distinct fatty odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of a carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 6-Methylheptanoic acid is used in the synthesis of esters for flavoring and fragrance applications, as well as in the production of surfactants and lubricants. Its branched structure can influence its physical properties, such as melting and boiling points, compared to straight-chain fatty acids. Additionally, it may exhibit biological activity, making it of interest in biochemical research and industrial applications.
Formula:C8H16O2
InChI:InChI=1S/C8H16O2/c1-7(2)5-3-4-6-8(9)10/h7H,3-6H2,1-2H3,(H,9,10)
InChI key:InChIKey=OEOIWYCWCDBOPA-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)CC(C)C
Synonyms:- 6-Methylheptanoic acid
- Heptanoic acid, 6-methyl-
- Isocaprylic acid
- iso-Caprylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-Methylheptanoic acid
CAS:<p>6-Methylheptanoic acid (6-methyl-heptanoic acid) is orally toxic and is involved in the synthesis of polymyxin B and colistin hapten PMB-A.</p>Formula:C8H16O2Purity:97.95%Color and Shape:SolidMolecular weight:144.216-Methylheptanoic Acid (>90%)
CAS:Controlled Product<p>Applications 6-Methylheptanoic acid is used as a reagent to synthesize analogues of Eponemycin, an antibiotic that also exhibits anti-angiogenic activity by inhibiting proteasome function. 6-Methylheptanoic acid naturally occurs as a component of the scent chemical of the brushtail possum.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References McLean, S., et al.: J. Chem. Ecol., 38, 1318 (2012); Oikawa, T., et al.: Biochem. Biophys. Res. Comm., 181, 1070 (1991); Sin, N., et al.: Bioorg. Med. Chem., 6, 1209 (1998)<br></p>Formula:C8H16O2Purity:>90%Color and Shape:NeatMolecular weight:144.21
