CAS 929-48-6
:8-Oxooctanoic acid
Description:
8-Oxooctanoic acid, also known as 8-oxooctanoate, is a carboxylic acid characterized by its eight-carbon chain with a ketone functional group at the eighth position. Its molecular formula is C8H14O3, indicating the presence of a carboxylic acid group (-COOH) and a carbonyl group (C=O). This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents and exhibits moderate solubility in water. 8-Oxooctanoic acid is known for its applications in organic synthesis and as an intermediate in the production of various chemical compounds. Its structure allows for potential reactivity in various chemical reactions, including esterification and condensation. Additionally, it may exhibit biological activity, making it of interest in biochemical research. Safety data indicates that, like many organic acids, it should be handled with care, as it can be irritating to skin and eyes. Proper storage and handling protocols should be followed to ensure safety in laboratory environments.
Formula:C8H14O3
InChI:InChI=1/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h7H,1-6H2,(H,10,11)
InChI key:InChIKey=UEXYJHLCLUYOFA-UHFFFAOYSA-N
SMILES:C(CCCC=O)CCC(O)=O
Synonyms:- 8-Oxooctanoic acid
- Octanoic acid, 8-oxo-
- Suberaldehydic acid
- 7-Formylheptanoic acid
- 8-OXOOCTANOICACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Formylheptanoic Acid
CAS:Controlled Product<p>Applications 7-Formylheptanoic Acid, is a fatty acid with keto.<br></p>Formula:C8H14O3Color and Shape:NeatMolecular weight:158.1958-Oxo-octanoic acid
CAS:<p>8-Oxo-octanoic acid is an oxo fatty acid that is naturally produced in the body. It is also found in urine and plasma samples. 8-Oxo-octanoic acid has been shown to be a product of lipid peroxidation and may increase the risk of cardiovascular disease. This compound is metabolized by esterases to form 8-oxo-nonanoic acid, which can be detected in urine samples. The presence of 8-oxo-octanoic acid in plasma can be used as a marker for oxidative stress.</p>Formula:C8H14O3Purity:Min. 95%Molecular weight:158.19 g/mol




