CymitQuimica logo

CAS 929000-58-8

:

1-(2-bromophenylsulfonyl)pyrrolidine

Description:
1-(2-Bromophenylsulfonyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a sulfonyl group attached to a bromophenyl moiety. This compound typically exhibits properties associated with both the pyrrolidine and sulfonyl functional groups, such as moderate polarity and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The sulfonyl group enhances the compound's ability to act as a leaving group in various chemical reactions. Additionally, the presence of the bromine atom may influence the compound's biological activity, making it of interest in medicinal chemistry. The compound's solubility is likely influenced by the polar sulfonyl group, while the aromatic bromophenyl portion may contribute to its stability and interaction with other molecules. Overall, 1-(2-bromophenylsulfonyl)pyrrolidine is a versatile compound with potential applications in organic synthesis and pharmaceutical development.
Formula:C10H12BrNO2S
InChI:InChI=1S/C10H12BrNO2S/c11-9-5-1-2-6-10(9)15(13,14)12-7-3-4-8-12/h1-2,5-6H,3-4,7-8H2
InChI key:CPLBBXUUEOJCKL-UHFFFAOYSA-N
SMILES:C1CCN(C1)S(=O)(=O)C2=CC=CC=C2Br
Found 4 products.