CAS 929012-36-2

(3R)-3-Methyl-2-azaspiro[4.4]nonane

Description:

(3R)-3-Methyl-2-azaspiro[4.4]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom integrated into a bicyclic framework. The compound features a chiral center at the 3-position, contributing to its stereochemistry and potentially influencing its biological activity. The presence of the azaspiro moiety suggests that it may exhibit interesting conformational properties and interactions due to the nitrogen atom's involvement in the ring system. This compound may be of interest in medicinal chemistry and drug design, particularly for its potential pharmacological properties. Its molecular structure allows for various functionalization possibilities, which can be explored for developing derivatives with enhanced activity or selectivity. Additionally, the compound's stability, solubility, and reactivity will depend on its specific substituents and the overall electronic environment created by the spiro arrangement. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems.

Formula: C₉H₁₇N

InChI: InChI=1S/C9H17N/c1-8-6-9(7-10-8)4-2-3-5-9/h8,10H,2-7H2,1H3/t8-/m1/s1

InChI key: InChIKey=NPBBRURTAYRIQO-MRVPVSSYSA-N

SMILES: C[C@@H]1CC2(CCCC2)CN1

Synonyms:

• (3R)-3-Methyl-2-azaspiro[4.4]nonane
• 2-Azaspiro[4.4]nonane, 3-methyl-, (3R)-