
CAS 929022-00-4
:β,β-Dimethyl-6-(trifluoromethyl)-2-pyridineethanamine
Description:
β,β-Dimethyl-6-(trifluoromethyl)-2-pyridineethanamine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The compound contains two methyl groups at the beta position relative to the amine, which can affect its steric properties and reactivity. As an amine, it may exhibit basicity and can participate in various chemical reactions, including alkylation and acylation. The pyridine moiety contributes to its aromatic character and potential interactions with biological targets. This compound may be explored for applications in pharmaceuticals or agrochemicals, given the significance of pyridine derivatives in these fields. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with regulations.
Formula:C10H13F3N2
InChI:InChI=1S/C10H13F3N2/c1-9(2,6-14)7-4-3-5-8(15-7)10(11,12)13/h3-5H,6,14H2,1-2H3
InChI key:InChIKey=RIPVEYQHCYGSTI-UHFFFAOYSA-N
SMILES:C(CN)(C)(C)C=1N=C(C(F)(F)F)C=CC1
Synonyms:- 2-Pyridineethanamine, β,β-dimethyl-6-(trifluoromethyl)-
- β,β-Dimethyl-6-(trifluoromethyl)-2-pyridineethanamine
- 2-Methyl-2-[6-(trifluoromethyl)pyridin-2-yl]propan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.