CymitQuimica logo

CAS 929028-74-0

:

Methyl 6-(acetylamino)-1,4-dihydro-4-oxo-2-quinolinecarboxylate

Description:
Methyl 6-(acetylamino)-1,4-dihydro-4-oxo-2-quinolinecarboxylate, with the CAS number 929028-74-0, is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound. This substance features a methyl ester functional group, an acetylamino group, and a diketone moiety, contributing to its potential biological activity. The presence of the acetylamino group suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as an intermediate in the synthesis of pharmaceuticals or as a bioactive compound. The dihydro-4-oxo structure indicates that it may participate in various chemical reactions, including nucleophilic attacks and cyclization processes. Additionally, the compound's solubility and stability can be influenced by the functional groups present, making it of interest for further studies in drug development and chemical synthesis. Overall, this compound's unique structural features may provide insights into its reactivity and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C13H12N2O4
InChI:InChI=1S/C13H12N2O4/c1-7(16)14-8-3-4-10-9(5-8)12(17)6-11(15-10)13(18)19-2/h3-6H,1-2H3,(H,14,16)(H,15,17)
InChI key:InChIKey=JNZLYYAFMTXECK-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(C(OC)=O)=C1)=CC=C(NC(C)=O)C2
Synonyms:
  • Methyl 6-(acetylamino)-1,4-dihydro-4-oxo-2-quinolinecarboxylate
  • 2-Quinolinecarboxylic acid, 6-(acetylamino)-1,4-dihydro-4-oxo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.