
CAS 929028-75-1
:1,4-Dihydro-4-oxo-6-(phenylmethoxy)-2-quinolinecarboxylic acid
Description:
1,4-Dihydro-4-oxo-6-(phenylmethoxy)-2-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of a carboxylic acid group and a quinoline moiety. The phenylmethoxy substituent enhances its lipophilicity, potentially influencing its solubility and biological activity. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structural features suggest potential interactions with biological targets, which could be explored in drug design. Additionally, the presence of the carbonyl group contributes to its reactivity and stability under certain conditions. Overall, this compound represents a unique scaffold that may be utilized in various chemical and pharmaceutical applications.
Formula:C17H13NO4
InChI:InChI=1S/C17H13NO4/c19-16-9-15(17(20)21)18-14-7-6-12(8-13(14)16)22-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,18,19)(H,20,21)
InChI key:InChIKey=RSWAHMHVZWQOBB-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(C(O)=O)=C1)=CC=C(OCC3=CC=CC=C3)C2
Synonyms:- 2-Quinolinecarboxylic acid, 1,4-dihydro-4-oxo-6-(phenylmethoxy)-
- 1,4-Dihydro-4-oxo-6-(phenylmethoxy)-2-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(Benzyloxy)-4-oxo-1,4-dihydroquinoline-2-carboxylic acid
CAS:Formula:C17H13NO4Molecular weight:295.2894
