CymitQuimica logo

CAS 929028-76-2

:

6-(Acetylamino)-1,4-dihydro-4-oxo-2-quinolinecarboxylic acid

Description:
6-(Acetylamino)-1,4-dihydro-4-oxo-2-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound. This substance features an acetylamino group, contributing to its potential biological activity. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The compound's diketone structure, indicated by the 4-oxo groups, suggests it may engage in tautomeric forms, influencing its reactivity and stability. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 929028-76-2, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, this compound's unique functional groups and structural features position it as a candidate for further research in various chemical and biological applications.
Formula:C12H10N2O4
InChI:InChI=1S/C12H10N2O4/c1-6(15)13-7-2-3-9-8(4-7)11(16)5-10(14-9)12(17)18/h2-5H,1H3,(H,13,15)(H,14,16)(H,17,18)
InChI key:InChIKey=ZUSOWMAQQPFCEF-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(C(O)=O)=C1)=CC=C(NC(C)=O)C2
Synonyms:
  • 6-(Acetylamino)-1,4-dihydro-4-oxo-2-quinolinecarboxylic acid
  • 2-Quinolinecarboxylic acid, 6-(acetylamino)-1,4-dihydro-4-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.