CAS 929047-23-4

3-Thiomorpholinecarboxylic acid, methyl ester, 1,1-dioxide

Description:

3-Thiomorpholinecarboxylic acid, methyl ester, 1,1-dioxide, identified by CAS number 929047-23-4, is a chemical compound characterized by its unique structural features. It contains a thiomorpholine ring, which is a six-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a carboxylic acid moiety, esterified with a methyl group, contributes to its reactivity and solubility properties. The 1,1-dioxide designation indicates the presence of two oxygen atoms bonded to the sulfur atom, enhancing the compound's polar characteristics and potentially influencing its biological activity. This compound may exhibit properties typical of thiomorpholine derivatives, such as potential applications in pharmaceuticals or agrochemicals, due to its ability to interact with biological systems. Its solubility in polar solvents and stability under various conditions make it a subject of interest in synthetic chemistry and medicinal research. As with many chemical substances, safety data and handling precautions should be observed when working with this compound.

Formula: C₆H₁₁NO₄S

InChI: InChI=1S/C6H11NO4S/c1-11-6(8)5-4-12(9,10)3-2-7-5/h5,7H,2-4H2,1H3

InChI key: InChIKey=ANJDRLZBIZGOSM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CS(=O)(=O)CCN1

Synonyms:

• 3-Thiomorpholinecarboxylic acid, methyl ester, 1,1-dioxide

3-​Thiomorpholinecarbox​ylic acid methyl ester 1,​1-​dioxide

CAS: 929047-23-4

Versatile small molecule scaffold

Formula: C₆H₁₁NO₄S

Purity: Min. 95%

Molecular weight: 193.22 g/mol

Ref: 3D-EMB04723