CAS 92911-21-2
:1-({3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propanoyl}oxy)pyrrolidine-2,5-dione
Description:
1-({3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propanoyl}oxy)pyrrolidine-2,5-dione, identified by its CAS number 92911-21-2, is a complex organic compound characterized by its unique structural features. It contains a phenothiazine moiety, which is known for its applications in pharmaceuticals, particularly as antipsychotic agents. The presence of a trifluoromethyl group enhances its lipophilicity and biological activity. The compound also features a pyrrolidine-2,5-dione structure, indicating potential reactivity and stability under certain conditions. Its molecular architecture suggests it may exhibit interesting pharmacological properties, possibly influencing neurotransmitter systems. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the trifluoromethyl group can significantly affect the compound's electronic properties, potentially enhancing its interaction with biological targets. Overall, this substance represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C20H15F3N2O4S
InChI:InChI=1/C20H15F3N2O4S/c21-20(22,23)12-5-6-16-14(11-12)24(13-3-1-2-4-15(13)30-16)10-9-19(28)29-25-17(26)7-8-18(25)27/h1-6,11H,7-10H2
SMILES:c1ccc2c(c1)N(CCC(=O)ON1C(=O)CCC1=O)c1cc(ccc1S2)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.