CAS 92917-44-7
:N-(2,6-dimethylphenyl)-N-nitrosoformamide
Description:
N-(2,6-dimethylphenyl)-N-nitrosoformamide, with the CAS number 92917-44-7, is a chemical compound that belongs to the class of nitroso compounds. It is characterized by the presence of a nitroso group (-NO) attached to a formamide moiety, which is further substituted with a 2,6-dimethylphenyl group. This structure imparts unique chemical properties, including potential reactivity due to the nitroso group, which can participate in various chemical reactions, such as nucleophilic attacks or redox processes. The compound may exhibit biological activity, and its derivatives are often studied for their potential applications in pharmaceuticals or as intermediates in organic synthesis. However, nitroso compounds can also pose health risks, including carcinogenicity, necessitating careful handling and assessment of safety. The physical properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other substances. As with any chemical, proper safety protocols should be followed when working with this compound.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c1-7-4-3-5-8(2)9(7)11(6-12)10-13/h3-6H,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
